C38H36O12 — CID 158796402
2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one (PubChem CID 158796402) has the molecular formula C38H36O12 and a molecular weight of 684.69 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 158796402 |
| Molecular Formula | C38H36O12 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccc(OC)c(OC)c3)oc2c1.COc1cc(OC)c2c(=O)cc(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/2C19H18O6/c2*1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h2*5-10H,1-4H3 |
| InChIKey | ISXKEJDWAAZAQF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 134.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |