C14H12N2O4 — CID 54102075
5,7-dimethoxy-2-(1H-pyrazol-5-yl)chromen-4-one (PubChem CID 54102075) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(1H-pyrazol-5-yl)chromen-4-one.
| Compound Name | 5,7-dimethoxy-2-(1H-pyrazol-5-yl)chromen-4-one |
|---|---|
| PubChem CID | 54102075 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5,7-dimethoxy-2-(1H-pyrazol-5-yl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccn[nH]3)oc2c1 |
| InChI | InChI=1S/C14H12N2O4/c1-18-8-5-12(19-2)14-10(17)7-11(20-13(14)6-8)9-3-4-15-16-9/h3-7H,1-2H3,(H,15,16) |
| InChIKey | NBENCLZGLPLUDF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |