C17H13FO3S — CID 154714196
2-(4-fluorophenyl)-5,7-dimethoxychromene-4-thione (PubChem CID 154714196) has the molecular formula C17H13FO3S and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5,7-dimethoxychromene-4-thione.
| Compound Name | 2-(4-fluorophenyl)-5,7-dimethoxychromene-4-thione |
|---|---|
| PubChem CID | 154714196 |
| Molecular Formula | C17H13FO3S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(4-fluorophenyl)-5,7-dimethoxychromene-4-thione |
| SMILES | COc1cc(OC)c2c(=S)cc(-c3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C17H13FO3S/c1-19-12-7-14(20-2)17-15(8-12)21-13(9-16(17)22)10-3-5-11(18)6-4-10/h3-9H,1-2H3 |
| InChIKey | BNLZHPDYXVGSPZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|