C17H14O3S — CID 56984400
5,7-dimethoxy-2-phenylchromene-4-thione (PubChem CID 56984400) has the molecular formula C17H14O3S and a molecular weight of 298.36 g/mol. Its IUPAC name is 5,7-dimethoxy-2-phenylchromene-4-thione.
| Compound Name | 5,7-dimethoxy-2-phenylchromene-4-thione |
|---|---|
| PubChem CID | 56984400 |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5,7-dimethoxy-2-phenylchromene-4-thione |
| SMILES | COc1cc(OC)c2c(=S)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C17H14O3S/c1-18-12-8-14(19-2)17-15(9-12)20-13(10-16(17)21)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | XZNZUXOKSXJGFS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|