C19H14O6 — CID 54749855
4-hydroxy-7,9-dimethoxy-3-phenylpyrano[3,2-b][1]benzofuran-2-one (PubChem CID 54749855) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-hydroxy-7,9-dimethoxy-3-phenylpyrano[3,2-b][1]benzofuran-2-one.
| Compound Name | 4-hydroxy-7,9-dimethoxy-3-phenylpyrano[3,2-b][1]benzofuran-2-one |
|---|---|
| PubChem CID | 54749855 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-hydroxy-7,9-dimethoxy-3-phenylpyrano[3,2-b][1]benzofuran-2-one |
| SMILES | COc1cc(OC)c2c(c1)oc1c(O)c(-c3ccccc3)c(=O)oc12 |
| InChI | InChI=1S/C19H14O6/c1-22-11-8-12(23-2)15-13(9-11)24-18-16(20)14(19(21)25-17(15)18)10-6-4-3-5-7-10/h3-9,20H,1-2H3 |
| InChIKey | VMUILSVTOYJNCC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |