C17H16O7 — CID 102460794
6-hydroxy-1,3,5,7-tetramethoxyxanthen-9-one (PubChem CID 102460794) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is 6-hydroxy-1,3,5,7-tetramethoxyxanthen-9-one.
| Compound Name | 6-hydroxy-1,3,5,7-tetramethoxyxanthen-9-one |
|---|---|
| PubChem CID | 102460794 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-hydroxy-1,3,5,7-tetramethoxyxanthen-9-one |
| SMILES | COc1cc(OC)c2c(=O)c3cc(OC)c(O)c(OC)c3oc2c1 |
| InChI | InChI=1S/C17H16O7/c1-20-8-5-10(21-2)13-11(6-8)24-16-9(14(13)18)7-12(22-3)15(19)17(16)23-4/h5-7,19H,1-4H3 |
| InChIKey | CYPTUXAPGYYRNQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|