C15H12O6 — CID 10016947
1,2-dihydroxy-5,6-dimethoxyxanthen-9-one (PubChem CID 10016947) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is 1,2-dihydroxy-5,6-dimethoxyxanthen-9-one.
| Compound Name | 1,2-dihydroxy-5,6-dimethoxyxanthen-9-one |
|---|---|
| PubChem CID | 10016947 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1,2-dihydroxy-5,6-dimethoxyxanthen-9-one |
| SMILES | COc1ccc2c(=O)c3c(O)c(O)ccc3oc2c1OC |
| InChI | InChI=1S/C15H12O6/c1-19-10-5-3-7-12(17)11-9(6-4-8(16)13(11)18)21-14(7)15(10)20-2/h3-6,16,18H,1-2H3 |
| InChIKey | LZLVACAUDLBOKV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|