About 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one
2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one (PubChem CID 162973215) has the molecular formula C16H14O7
and a molecular weight of 318.28 g/mol. Its IUPAC name is 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one.
Molecular Properties
| Compound Name | 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one |
| PubChem CID | 162973215 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one |
| SMILES | COc1ccc2c(=O)c3c(OC)c(O)cc(O)c3oc2c1OC |
| InChI | InChI=1S/C16H14O7/c1-20-10-5-4-7-12(19)11-14(21-2)8(17)6-9(18)15(11)23-13(7)16(10)22-3/h4-6,17-18H,1-3H3 |
| InChIKey | DDSBGWZLXYXUCB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one?
The IUPAC name of 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one (CID 162973215) is 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one.
What is the SMILES notation for 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one?
The canonical SMILES for 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one is COc1ccc2c(=O)c3c(OC)c(O)cc(O)c3oc2c1OC.
What is the InChIKey of 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one?
The InChIKey is DDSBGWZLXYXUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O7/c1-20-10-5-4-7-12(19)11-14(21-2)8(17)6-9(18)15(11)23-13(7)16(10)22-3/h4-6,17-18H,1-3H3.
What are the key properties of 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one?
2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one has a molecular weight of 318.28 g/mol, XLogP of 2.38, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-1,5,6-trimethoxyxanthen-9-one is sourced from PubChem (CID 162973215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).