About 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde
4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde (PubChem CID 73357056) has the molecular formula C24H20O7
and a molecular weight of 420.42 g/mol. Its IUPAC name is 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde |
| PubChem CID | 73357056 |
| Molecular Formula | C24H20O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde |
| SMILES | COc1ccc2c(=O)c3c(OC)cc(OC)c(-c4ccc(C=O)cc4)c3oc2c1OC |
| InChI | InChI=1S/C24H20O7/c1-27-16-10-9-15-21(26)20-18(29-3)11-17(28-2)19(14-7-5-13(12-25)6-8-14)24(20)31-22(15)23(16)30-4/h5-12H,1-4H3 |
| InChIKey | YHSGZHIVYVAIRU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde?
The IUPAC name of 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde (CID 73357056) is 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde.
What is the SMILES notation for 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde?
The canonical SMILES for 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde is COc1ccc2c(=O)c3c(OC)cc(OC)c(-c4ccc(C=O)cc4)c3oc2c1OC.
What is the InChIKey of 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde?
The InChIKey is YHSGZHIVYVAIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O7/c1-27-16-10-9-15-21(26)20-18(29-3)11-17(28-2)19(14-7-5-13(12-25)6-8-14)24(20)31-22(15)23(16)30-4/h5-12H,1-4H3.
What are the key properties of 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde?
4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde has a molecular weight of 420.42 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,5,6-tetramethoxy-9-oxoxanthen-4-yl)benzaldehyde is sourced from PubChem (CID 73357056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).