C26H18Br2O4 — CID 91174608
3,4-bis(4-bromophenyl)-2,7-dimethoxynaphthalene-1,8-dicarbaldehyde (PubChem CID 91174608) has the molecular formula C26H18Br2O4 and a molecular weight of 554.23 g/mol. Its IUPAC name is 3,4-bis(4-bromophenyl)-2,7-dimethoxynaphthalene-1,8-dicarbaldehyde.
| Compound Name | 3,4-bis(4-bromophenyl)-2,7-dimethoxynaphthalene-1,8-dicarbaldehyde |
|---|---|
| PubChem CID | 91174608 |
| Molecular Formula | C26H18Br2O4 |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 551.96 |
| IUPAC Name | 3,4-bis(4-bromophenyl)-2,7-dimethoxynaphthalene-1,8-dicarbaldehyde |
| SMILES | COc1ccc2c(-c3ccc(Br)cc3)c(-c3ccc(Br)cc3)c(OC)c(C=O)c2c1C=O |
| InChI | InChI=1S/C26H18Br2O4/c1-31-22-12-11-19-23(15-3-7-17(27)8-4-15)24(16-5-9-18(28)10-6-16)26(32-2)21(14-30)25(19)20(22)13-29/h3-14H,1-2H3 |
| InChIKey | YZLIXUIDWPPJNX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|