C32H26O6 — CID 101191767
4-[10-(4-formylphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzaldehyde (PubChem CID 101191767) has the molecular formula C32H26O6 and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-[10-(4-formylphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzaldehyde.
| Compound Name | 4-[10-(4-formylphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzaldehyde |
|---|---|
| PubChem CID | 101191767 |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 4-[10-(4-formylphenyl)-2,3,6,7-tetramethoxyanthracen-9-yl]benzaldehyde |
| SMILES | COc1cc2c(-c3ccc(C=O)cc3)c3cc(OC)c(OC)cc3c(-c3ccc(C=O)cc3)c2cc1OC |
| InChI | InChI=1S/C32H26O6/c1-35-27-13-23-24(14-28(27)36-2)32(22-11-7-20(18-34)8-12-22)26-16-30(38-4)29(37-3)15-25(26)31(23)21-9-5-19(17-33)6-10-21/h5-18H,1-4H3 |
| InChIKey | DZFOIAMYBIBJHV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|