C28H30O6 — CID 11271183
4-[4-(4-formylphenyl)-2,3,5,6-tetrakis(methoxymethyl)phenyl]benzaldehyde (PubChem CID 11271183) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is 4-[4-(4-formylphenyl)-2,3,5,6-tetrakis(methoxymethyl)phenyl]benzaldehyde.
| Compound Name | 4-[4-(4-formylphenyl)-2,3,5,6-tetrakis(methoxymethyl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 11271183 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-[4-(4-formylphenyl)-2,3,5,6-tetrakis(methoxymethyl)phenyl]benzaldehyde |
| SMILES | COCc1c(COC)c(-c2ccc(C=O)cc2)c(COC)c(COC)c1-c1ccc(C=O)cc1 |
| InChI | InChI=1S/C28H30O6/c1-31-15-23-24(16-32-2)28(22-11-7-20(14-30)8-12-22)26(18-34-4)25(17-33-3)27(23)21-9-5-19(13-29)6-10-21/h5-14H,15-18H2,1-4H3 |
| InChIKey | LUECDFJAODAINF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|