About 4-ethenylbenzaldehyde;methoxyethane
4-ethenylbenzaldehyde;methoxyethane (PubChem CID 142202531) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-ethenylbenzaldehyde;methoxyethane.
Molecular Properties
| Compound Name | 4-ethenylbenzaldehyde;methoxyethane |
| PubChem CID | 142202531 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-ethenylbenzaldehyde;methoxyethane |
| SMILES | C=Cc1ccc(C=O)cc1.CCOC |
| InChI | InChI=1S/C9H8O.C3H8O/c1-2-8-3-5-9(7-10)6-4-8;1-3-4-2/h2-7H,1H2;3H2,1-2H3 |
| InChIKey | KBESIAZZPRLDPH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylbenzaldehyde;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylbenzaldehyde;methoxyethane?
The IUPAC name of 4-ethenylbenzaldehyde;methoxyethane (CID 142202531) is 4-ethenylbenzaldehyde;methoxyethane.
What is the SMILES notation for 4-ethenylbenzaldehyde;methoxyethane?
The canonical SMILES for 4-ethenylbenzaldehyde;methoxyethane is C=Cc1ccc(C=O)cc1.CCOC.
What is the InChIKey of 4-ethenylbenzaldehyde;methoxyethane?
The InChIKey is KBESIAZZPRLDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C3H8O/c1-2-8-3-5-9(7-10)6-4-8;1-3-4-2/h2-7H,1H2;3H2,1-2H3.
What are the key properties of 4-ethenylbenzaldehyde;methoxyethane?
4-ethenylbenzaldehyde;methoxyethane has a molecular weight of 192.26 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylbenzaldehyde;methoxyethane is sourced from PubChem (CID 142202531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).