C8H8O2 — CID 46780459
4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde (PubChem CID 46780459) has the molecular formula C8H8O2 and a molecular weight of 142.10 g/mol. Its IUPAC name is 4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde.
| Compound Name | 4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 46780459 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 142.10 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde |
| SMILES | CO[13c]1[13cH][13cH][13c](C=O)[13cH][13cH]1 |
| InChI | InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3/i2+1,3+1,4+1,5+1,7+1,8+1 |
| InChIKey | ZRSNZINYAWTAHE-CLQMYPOBSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|