C41H34N2O4 — CID 58214212
4-[N-(4-formylphenyl)-4-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methyl]anilino]benzaldehyde (PubChem CID 58214212) has the molecular formula C41H34N2O4 and a molecular weight of 618.73 g/mol. Its IUPAC name is 4-[N-(4-formylphenyl)-4-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methyl]anilino]benzaldehyde.
| Compound Name | 4-[N-(4-formylphenyl)-4-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methyl]anilino]benzaldehyde |
|---|---|
| PubChem CID | 58214212 |
| Molecular Formula | C41H34N2O4 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 4-[N-(4-formylphenyl)-4-[[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]methyl]anilino]benzaldehyde |
| SMILES | COc1ccc(N(c2ccc(Cc3ccc(N(c4ccc(C=O)cc4)c4ccc(C=O)cc4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H34N2O4/c1-46-40-23-19-38(20-24-40)43(39-21-25-41(47-2)26-22-39)35-13-5-31(6-14-35)27-30-3-11-34(12-4-30)42(36-15-7-32(28-44)8-16-36)37-17-9-33(29-45)10-18-37/h3-26,28-29H,27H2,1-2H3 |
| InChIKey | MVBSYZKSPSUYES-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|