C44H42N2O2 — CID 89418016
4-[N-(3,4-dimethylphenyl)-4-[2-[4-(N-(3,4-dimethylphenyl)-4-methoxyanilino)phenyl]ethyl]anilino]benzaldehyde (PubChem CID 89418016) has the molecular formula C44H42N2O2 and a molecular weight of 630.83 g/mol. Its IUPAC name is 4-[N-(3,4-dimethylphenyl)-4-[2-[4-(N-(3,4-dimethylphenyl)-4-methoxyanilino)phenyl]ethyl]anilino]benzaldehyde.
| Compound Name | 4-[N-(3,4-dimethylphenyl)-4-[2-[4-(N-(3,4-dimethylphenyl)-4-methoxyanilino)phenyl]ethyl]anilino]benzaldehyde |
|---|---|
| PubChem CID | 89418016 |
| Molecular Formula | C44H42N2O2 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 4-[N-(3,4-dimethylphenyl)-4-[2-[4-(N-(3,4-dimethylphenyl)-4-methoxyanilino)phenyl]ethyl]anilino]benzaldehyde |
| SMILES | COc1ccc(N(c2ccc(CCc3ccc(N(c4ccc(C=O)cc4)c4ccc(C)c(C)c4)cc3)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C44H42N2O2/c1-31-6-16-42(28-33(31)3)45(40-22-14-37(30-47)15-23-40)38-18-10-35(11-19-38)8-9-36-12-20-39(21-13-36)46(41-24-26-44(48-5)27-25-41)43-17-7-32(2)34(4)29-43/h6-7,10-30H,8-9H2,1-5H3 |
| InChIKey | RNUQWGZQGXUDLE-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|