C32H26N2O2 — CID 22973932
4-(N-[4-(N-(4-methoxyphenyl)anilino)phenyl]anilino)benzaldehyde (PubChem CID 22973932) has the molecular formula C32H26N2O2 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-(N-[4-(N-(4-methoxyphenyl)anilino)phenyl]anilino)benzaldehyde.
| Compound Name | 4-(N-[4-(N-(4-methoxyphenyl)anilino)phenyl]anilino)benzaldehyde |
|---|---|
| PubChem CID | 22973932 |
| Molecular Formula | C32H26N2O2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-(N-[4-(N-(4-methoxyphenyl)anilino)phenyl]anilino)benzaldehyde |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(N(c3ccccc3)c3ccc(C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26N2O2/c1-36-32-22-20-31(21-23-32)34(27-10-6-3-7-11-27)30-18-16-29(17-19-30)33(26-8-4-2-5-9-26)28-14-12-25(24-35)13-15-28/h2-24H,1H3 |
| InChIKey | HJBJASLHWRANTQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|