About 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde
4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde (PubChem CID 143277732) has the molecular formula C22H22O3S
and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde |
| PubChem CID | 143277732 |
| Molecular Formula | C22H22O3S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde |
| SMILES | COc1ccc(S(C)(c2ccc(C=O)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H22O3S/c1-24-18-6-12-21(13-7-18)26(3,20-10-4-17(16-23)5-11-20)22-14-8-19(25-2)9-15-22/h4-16H,1-3H3 |
| InChIKey | UBVQKPVPWXANTG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde?
The IUPAC name of 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde (CID 143277732) is 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde.
What is the SMILES notation for 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde?
The canonical SMILES for 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde is COc1ccc(S(C)(c2ccc(C=O)cc2)c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde?
The InChIKey is UBVQKPVPWXANTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O3S/c1-24-18-6-12-21(13-7-18)26(3,20-10-4-17(16-23)5-11-20)22-14-8-19(25-2)9-15-22/h4-16H,1-3H3.
What are the key properties of 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde?
4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde has a molecular weight of 366.48 g/mol, XLogP of 5.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(4-methoxyphenyl)-methyl-λ4-sulfanyl]benzaldehyde is sourced from PubChem (CID 143277732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).