About imino(diphenoxy)phosphanium;methoxyethane;styrene
imino(diphenoxy)phosphanium;methoxyethane;styrene (PubChem CID 161271486) has the molecular formula C23H27NO3P+
and a molecular weight of 396.45 g/mol. Its IUPAC name is imino(diphenoxy)phosphanium;methoxyethane;styrene.
Molecular Properties
| Compound Name | imino(diphenoxy)phosphanium;methoxyethane;styrene |
| PubChem CID | 161271486 |
| Molecular Formula | C23H27NO3P+ |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | imino(diphenoxy)phosphanium;methoxyethane;styrene |
| SMILES | C=Cc1ccccc1.CCOC.[H]N=[P+](Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H11NO2P.C8H8.C3H8O/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-2-8-6-4-3-5-7-8;1-3-4-2/h1-10,13H;2-7H,1H2;3H2,1-2H3/q+1;; |
| InChIKey | SZOVEZYVEFSJPS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze imino(diphenoxy)phosphanium;methoxyethane;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino(diphenoxy)phosphanium;methoxyethane;styrene?
The IUPAC name of imino(diphenoxy)phosphanium;methoxyethane;styrene (CID 161271486) is imino(diphenoxy)phosphanium;methoxyethane;styrene.
What is the SMILES notation for imino(diphenoxy)phosphanium;methoxyethane;styrene?
The canonical SMILES for imino(diphenoxy)phosphanium;methoxyethane;styrene is C=Cc1ccccc1.CCOC.[H]N=[P+](Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of imino(diphenoxy)phosphanium;methoxyethane;styrene?
The InChIKey is SZOVEZYVEFSJPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2P.C8H8.C3H8O/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-2-8-6-4-3-5-7-8;1-3-4-2/h1-10,13H;2-7H,1H2;3H2,1-2H3/q+1;;.
What are the key properties of imino(diphenoxy)phosphanium;methoxyethane;styrene?
imino(diphenoxy)phosphanium;methoxyethane;styrene has a molecular weight of 396.45 g/mol, XLogP of 7.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imino(diphenoxy)phosphanium;methoxyethane;styrene is sourced from PubChem (CID 161271486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).