C30H24Cl2O4 — CID 56602037
9,10-bis(4-chlorophenyl)-2,3,6,7-tetramethoxyanthracene (PubChem CID 56602037) has the molecular formula C30H24Cl2O4 and a molecular weight of 519.42 g/mol. Its IUPAC name is 9,10-bis(4-chlorophenyl)-2,3,6,7-tetramethoxyanthracene.
| Compound Name | 9,10-bis(4-chlorophenyl)-2,3,6,7-tetramethoxyanthracene |
|---|---|
| PubChem CID | 56602037 |
| Molecular Formula | C30H24Cl2O4 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 9,10-bis(4-chlorophenyl)-2,3,6,7-tetramethoxyanthracene |
| SMILES | COc1cc2c(-c3ccc(Cl)cc3)c3cc(OC)c(OC)cc3c(-c3ccc(Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C30H24Cl2O4/c1-33-25-13-21-22(14-26(25)34-2)30(18-7-11-20(32)12-8-18)24-16-28(36-4)27(35-3)15-23(24)29(21)17-5-9-19(31)10-6-17/h5-16H,1-4H3 |
| InChIKey | DQMBAURMKXQHNA-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|