C15H16ClNO2 — CID 54911492
[2-(4-chlorophenyl)-4,5-dimethoxyphenyl]methanamine (PubChem CID 54911492) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-4,5-dimethoxyphenyl]methanamine.
| Compound Name | [2-(4-chlorophenyl)-4,5-dimethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 54911492 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | [2-(4-chlorophenyl)-4,5-dimethoxyphenyl]methanamine |
| SMILES | COc1cc(CN)c(-c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C15H16ClNO2/c1-18-14-7-11(9-17)13(8-15(14)19-2)10-3-5-12(16)6-4-10/h3-8H,9,17H2,1-2H3 |
| InChIKey | LRGOZKXBZALAQM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |