C15H14ClF2NO2 — CID 107476915
[2-(2-chloro-4,5-difluorophenyl)-4,5-dimethoxyphenyl]methanamine (PubChem CID 107476915) has the molecular formula C15H14ClF2NO2 and a molecular weight of 313.73 g/mol. Its IUPAC name is [2-(2-chloro-4,5-difluorophenyl)-4,5-dimethoxyphenyl]methanamine.
| Compound Name | [2-(2-chloro-4,5-difluorophenyl)-4,5-dimethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 107476915 |
| Molecular Formula | C15H14ClF2NO2 |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [2-(2-chloro-4,5-difluorophenyl)-4,5-dimethoxyphenyl]methanamine |
| SMILES | COc1cc(CN)c(-c2cc(F)c(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H14ClF2NO2/c1-20-14-3-8(7-19)9(5-15(14)21-2)10-4-12(17)13(18)6-11(10)16/h3-6H,7,19H2,1-2H3 |
| InChIKey | CKCCMJUZZXVPGI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|