C17H21NO3 — CID 62800398
[2-(2-ethoxyphenyl)-4,5-dimethoxyphenyl]methanamine (PubChem CID 62800398) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is [2-(2-ethoxyphenyl)-4,5-dimethoxyphenyl]methanamine.
| Compound Name | [2-(2-ethoxyphenyl)-4,5-dimethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 62800398 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [2-(2-ethoxyphenyl)-4,5-dimethoxyphenyl]methanamine |
| SMILES | CCOc1ccccc1-c1cc(OC)c(OC)cc1CN |
| InChI | InChI=1S/C17H21NO3/c1-4-21-15-8-6-5-7-13(15)14-10-17(20-3)16(19-2)9-12(14)11-18/h5-10H,4,11,18H2,1-3H3 |
| InChIKey | CHWOJJBETKJCDF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |