C15H15ClO3 — CID 57161799
1-(4-chlorophenyl)-2,3,4-trimethoxybenzene (PubChem CID 57161799) has the molecular formula C15H15ClO3 and a molecular weight of 278.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(4-chlorophenyl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 57161799 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-(4-chlorophenyl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(-c2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C15H15ClO3/c1-17-13-9-8-12(14(18-2)15(13)19-3)10-4-6-11(16)7-5-10/h4-9H,1-3H3 |
| InChIKey | FJPNKRKERSAOIU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |