C15H14O4 — CID 118874779
4-(2,4-dimethoxyphenoxy)benzaldehyde (PubChem CID 118874779) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenoxy)benzaldehyde.
| Compound Name | 4-(2,4-dimethoxyphenoxy)benzaldehyde |
|---|---|
| PubChem CID | 118874779 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-(2,4-dimethoxyphenoxy)benzaldehyde |
| SMILES | COc1ccc(Oc2ccc(C=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H14O4/c1-17-13-7-8-14(15(9-13)18-2)19-12-5-3-11(10-16)4-6-12/h3-10H,1-2H3 |
| InChIKey | YUFVRIZPOJIFCC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|