C19H18O6 — CID 638205
3-(3,4-dimethoxyphenyl)-7,8-dimethoxychromen-4-one (PubChem CID 638205) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7,8-dimethoxychromen-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7,8-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 638205 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7,8-dimethoxychromen-4-one |
| SMILES | COc1ccc(-c2coc3c(OC)c(OC)ccc3c2=O)cc1OC |
| InChI | InChI=1S/C19H18O6/c1-21-14-7-5-11(9-16(14)23-3)13-10-25-18-12(17(13)20)6-8-15(22-2)19(18)24-4/h5-10H,1-4H3 |
| InChIKey | NSPBRNGTERFXKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |