C29H26O9 — CID 125122047
(10S)-3-(3,4-dimethoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 125122047) has the molecular formula C29H26O9 and a molecular weight of 518.52 g/mol. Its IUPAC name is (10S)-3-(3,4-dimethoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10S)-3-(3,4-dimethoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 125122047 |
| Molecular Formula | C29H26O9 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (10S)-3-(3,4-dimethoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(ccc3c2=O)OC(=O)C[C@H]4c2ccc(OC)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C29H26O9/c1-32-20-9-6-15(12-23(20)34-3)19-14-37-27-17(26(19)31)8-10-21-25(27)18(13-24(30)38-21)16-7-11-22(33-2)29(36-5)28(16)35-4/h6-12,14,18H,13H2,1-5H3/t18-/m0/s1 |
| InChIKey | CGILUMUIOPIBJP-SFHVURJKSA-N |
| XLogP | 4.94 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|