C32H25NO7 — CID 126418919
(10S)-3-(3,4-dimethoxyphenyl)-10-[2-(pyridin-2-ylmethoxy)phenyl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 126418919) has the molecular formula C32H25NO7 and a molecular weight of 535.55 g/mol. Its IUPAC name is (10S)-3-(3,4-dimethoxyphenyl)-10-[2-(pyridin-2-ylmethoxy)phenyl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10S)-3-(3,4-dimethoxyphenyl)-10-[2-(pyridin-2-ylmethoxy)phenyl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 126418919 |
| Molecular Formula | C32H25NO7 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (10S)-3-(3,4-dimethoxyphenyl)-10-[2-(pyridin-2-ylmethoxy)phenyl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(ccc3c2=O)OC(=O)C[C@H]4c2ccccc2OCc2ccccn2)cc1OC |
| InChI | InChI=1S/C32H25NO7/c1-36-26-12-10-19(15-28(26)37-2)24-18-39-32-22(31(24)35)11-13-27-30(32)23(16-29(34)40-27)21-8-3-4-9-25(21)38-17-20-7-5-6-14-33-20/h3-15,18,23H,16-17H2,1-2H3/t23-/m0/s1 |
| InChIKey | KYMSOJRFRUHAIG-QHCPKHFHSA-N |
| XLogP | 5.89 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|