C30H22N2O7 — CID 125429871
(10S)-3-(3,4-dimethoxyphenyl)-10-(3-pyrimidin-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 125429871) has the molecular formula C30H22N2O7 and a molecular weight of 522.51 g/mol. Its IUPAC name is (10S)-3-(3,4-dimethoxyphenyl)-10-(3-pyrimidin-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10S)-3-(3,4-dimethoxyphenyl)-10-(3-pyrimidin-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 125429871 |
| Molecular Formula | C30H22N2O7 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (10S)-3-(3,4-dimethoxyphenyl)-10-(3-pyrimidin-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(ccc3c2=O)OC(=O)C[C@H]4c2cccc(Oc3ncccn3)c2)cc1OC |
| InChI | InChI=1S/C30H22N2O7/c1-35-23-9-7-18(14-25(23)36-2)22-16-37-29-20(28(22)34)8-10-24-27(29)21(15-26(33)39-24)17-5-3-6-19(13-17)38-30-31-11-4-12-32-30/h3-14,16,21H,15H2,1-2H3/t21-/m0/s1 |
| InChIKey | QHFDWUMACZMQEB-NRFANRHFSA-N |
| XLogP | 5.50 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|