C32H24O7 — CID 97488105
(10R)-3-(4-hydroxyphenyl)-10-(3-methoxy-4-phenylmethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 97488105) has the molecular formula C32H24O7 and a molecular weight of 520.54 g/mol. Its IUPAC name is (10R)-3-(4-hydroxyphenyl)-10-(3-methoxy-4-phenylmethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10R)-3-(4-hydroxyphenyl)-10-(3-methoxy-4-phenylmethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488105 |
| Molecular Formula | C32H24O7 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (10R)-3-(4-hydroxyphenyl)-10-(3-methoxy-4-phenylmethoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1cc([C@H]2CC(=O)Oc3ccc4c(=O)c(-c5ccc(O)cc5)coc4c32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H24O7/c1-36-28-15-21(9-13-26(28)37-17-19-5-3-2-4-6-19)24-16-29(34)39-27-14-12-23-31(35)25(18-38-32(23)30(24)27)20-7-10-22(33)11-8-20/h2-15,18,24,33H,16-17H2,1H3/t24-/m1/s1 |
| InChIKey | HTMRNKVWUNYOGN-XMMPIXPASA-N |
| XLogP | 6.19 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|