C25H18O6 — CID 124874022
(10R)-10-(3-hydroxy-4-methoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 124874022) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is (10R)-10-(3-hydroxy-4-methoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10R)-10-(3-hydroxy-4-methoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 124874022 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (10R)-10-(3-hydroxy-4-methoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1ccc([C@H]2CC(=O)Oc3ccc4c(=O)c(-c5ccccc5)coc4c32)cc1O |
| InChI | InChI=1S/C25H18O6/c1-29-20-9-7-15(11-19(20)26)17-12-22(27)31-21-10-8-16-24(28)18(13-30-25(16)23(17)21)14-5-3-2-4-6-14/h2-11,13,17,26H,12H2,1H3/t17-/m1/s1 |
| InChIKey | AMZRPWXKUDAIPQ-QGZVFWFLSA-N |
| XLogP | 4.62 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|