C27H22O6 — CID 75491285
3-(4-hydroxyphenyl)-10-(4-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 75491285) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-10-(4-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 3-(4-hydroxyphenyl)-10-(4-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 75491285 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-(4-hydroxyphenyl)-10-(4-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | CC(C)Oc1ccc(C2CC(=O)Oc3ccc4c(=O)c(-c5ccc(O)cc5)coc4c32)cc1 |
| InChI | InChI=1S/C27H22O6/c1-15(2)32-19-9-5-16(6-10-19)21-13-24(29)33-23-12-11-20-26(30)22(14-31-27(20)25(21)23)17-3-7-18(28)8-4-17/h3-12,14-15,21,28H,13H2,1-2H3 |
| InChIKey | FWSBBNGRABZQOL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|