C27H16O7 — CID 97488656
(10R)-3-(4-hydroxyphenyl)-10-(4-oxochromen-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 97488656) has the molecular formula C27H16O7 and a molecular weight of 452.42 g/mol. Its IUPAC name is (10R)-3-(4-hydroxyphenyl)-10-(4-oxochromen-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10R)-3-(4-hydroxyphenyl)-10-(4-oxochromen-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 97488656 |
| Molecular Formula | C27H16O7 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (10R)-3-(4-hydroxyphenyl)-10-(4-oxochromen-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2coc3ccccc3c2=O)c2c(ccc3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
| InChI | InChI=1S/C27H16O7/c28-15-7-5-14(6-8-15)19-12-33-27-17(26(19)31)9-10-22-24(27)18(11-23(29)34-22)20-13-32-21-4-2-1-3-16(21)25(20)30/h1-10,12-13,18,28H,11H2/t18-/m0/s1 |
| InChIKey | XWFKIYVRUNXZDK-SFHVURJKSA-N |
| XLogP | 4.71 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|