C27H16FNO5 — CID 124917636
(10R)-3-(4-fluorophenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 124917636) has the molecular formula C27H16FNO5 and a molecular weight of 453.43 g/mol. Its IUPAC name is (10R)-3-(4-fluorophenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10R)-3-(4-fluorophenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 124917636 |
| Molecular Formula | C27H16FNO5 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (10R)-3-(4-fluorophenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2cc3ccccc3[nH]c2=O)c2c(ccc3c(=O)c(-c4ccc(F)cc4)coc23)O1 |
| InChI | InChI=1S/C27H16FNO5/c28-16-7-5-14(6-8-16)20-13-33-26-17(25(20)31)9-10-22-24(26)18(12-23(30)34-22)19-11-15-3-1-2-4-21(15)29-27(19)32/h1-11,13,18H,12H2,(H,29,32)/t18-/m0/s1 |
| InChIKey | KHANYFLSGOSDQI-SFHVURJKSA-N |
| XLogP | 4.88 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|