C28H19NO7 — CID 125429092
(10R)-5-hydroxy-3-(2-methoxyphenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125429092) has the molecular formula C28H19NO7 and a molecular weight of 481.46 g/mol. Its IUPAC name is (10R)-5-hydroxy-3-(2-methoxyphenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-3-(2-methoxyphenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125429092 |
| Molecular Formula | C28H19NO7 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (10R)-5-hydroxy-3-(2-methoxyphenyl)-10-(2-oxo-1H-quinolin-3-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccccc1-c1coc2c3c(cc(O)c2c1=O)OC(=O)C[C@H]3c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C28H19NO7/c1-34-21-9-5-3-7-15(21)18-13-35-27-24-16(17-10-14-6-2-4-8-19(14)29-28(17)33)11-23(31)36-22(24)12-20(30)25(27)26(18)32/h2-10,12-13,16,30H,11H2,1H3,(H,29,33)/t16-/m0/s1 |
| InChIKey | KTBQBLOVWJCBDS-INIZCTEOSA-N |
| XLogP | 4.46 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|