C29H20O6 — CID 97045925
(10R)-5-hydroxy-3-(4-methoxyphenyl)-10-naphthalen-1-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97045925) has the molecular formula C29H20O6 and a molecular weight of 464.47 g/mol. Its IUPAC name is (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-naphthalen-1-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-naphthalen-1-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97045925 |
| Molecular Formula | C29H20O6 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-naphthalen-1-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)C[C@@H]4c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C29H20O6/c1-33-18-11-9-17(10-12-18)22-15-34-29-26-21(20-8-4-6-16-5-2-3-7-19(16)20)13-25(31)35-24(26)14-23(30)27(29)28(22)32/h2-12,14-15,21,30H,13H2,1H3/t21-/m1/s1 |
| InChIKey | LMBALRLGSQCFTD-OAQYLSRUSA-N |
| XLogP | 5.77 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|