C28H24O9 — CID 71754809
5-hydroxy-3-(4-methoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71754809) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is 5-hydroxy-3-(4-methoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-3-(4-methoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71754809 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)CC4c2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C28H24O9/c1-32-15-7-5-14(6-8-15)18-13-36-28-23-17(16-9-10-20(33-2)27(35-4)26(16)34-3)11-22(30)37-21(23)12-19(29)24(28)25(18)31/h5-10,12-13,17,29H,11H2,1-4H3 |
| InChIKey | GGFMXSAIZQIOFQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|