C27H18N2O6 — CID 97045635
(10R)-5-hydroxy-3-(4-methoxyphenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97045635) has the molecular formula C27H18N2O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97045635 |
| Molecular Formula | C27H18N2O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (10R)-5-hydroxy-3-(4-methoxyphenyl)-10-quinoxalin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)C[C@@H]4c2ccc3nccnc3c2)cc1 |
| InChI | InChI=1S/C27H18N2O6/c1-33-16-5-2-14(3-6-16)18-13-34-27-24-17(15-4-7-19-20(10-15)29-9-8-28-19)11-23(31)35-22(24)12-21(30)25(27)26(18)32/h2-10,12-13,17,30H,11H2,1H3/t17-/m1/s1 |
| InChIKey | IRUPROMFJGDMSH-QGZVFWFLSA-N |
| XLogP | 4.56 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|