C30H26O8 — CID 97045587
(10S)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97045587) has the molecular formula C30H26O8 and a molecular weight of 514.53 g/mol. Its IUPAC name is (10S)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97045587 |
| Molecular Formula | C30H26O8 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (10S)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | C=C(C)COc1ccc([C@@H]2CC(=O)Oc3cc(O)c4c(=O)c(-c5ccc(OC)cc5)coc4c32)cc1OC |
| InChI | InChI=1S/C30H26O8/c1-16(2)14-36-23-10-7-18(11-24(23)35-4)20-12-26(32)38-25-13-22(31)28-29(33)21(15-37-30(28)27(20)25)17-5-8-19(34-3)9-6-17/h5-11,13,15,20,31H,1,12,14H2,2-4H3/t20-/m0/s1 |
| InChIKey | GGDUBAWAUCRSTC-FQEVSTJZSA-N |
| XLogP | 5.58 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|