C31H28O9 — CID 125123138
(10S)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125123138) has the molecular formula C31H28O9 and a molecular weight of 544.56 g/mol. Its IUPAC name is (10S)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125123138 |
| Molecular Formula | C31H28O9 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (10S)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | C=C(C)COc1ccc([C@@H]2CC(=O)Oc3cc(O)c4c(=O)c(-c5ccc(OC)c(OC)c5)coc4c32)cc1OC |
| InChI | InChI=1S/C31H28O9/c1-16(2)14-38-23-9-7-17(10-25(23)37-5)19-12-27(33)40-26-13-21(32)29-30(34)20(15-39-31(29)28(19)26)18-6-8-22(35-3)24(11-18)36-4/h6-11,13,15,19,32H,1,12,14H2,2-5H3/t19-/m0/s1 |
| InChIKey | VXSDFOYTDMRXFX-IBGZPJMESA-N |
| XLogP | 5.59 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|