C29H22O8 — CID 125123092
(10S)-10-(2H-chromen-3-yl)-3-(3,4-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125123092) has the molecular formula C29H22O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is (10S)-10-(2H-chromen-3-yl)-3-(3,4-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-10-(2H-chromen-3-yl)-3-(3,4-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125123092 |
| Molecular Formula | C29H22O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (10S)-10-(2H-chromen-3-yl)-3-(3,4-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)C[C@H]4C2=Cc3ccccc3OC2)cc1OC |
| InChI | InChI=1S/C29H22O8/c1-33-22-8-7-15(10-23(22)34-2)19-14-36-29-26-18(17-9-16-5-3-4-6-21(16)35-13-17)11-25(31)37-24(26)12-20(30)27(29)28(19)32/h3-10,12,14,18,30H,11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | VDJSOVMZKIXPMQ-SFHVURJKSA-N |
| XLogP | 5.05 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|