C29H21NO7 — CID 125122445
(10R)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-quinolin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125122445) has the molecular formula C29H21NO7 and a molecular weight of 495.49 g/mol. Its IUPAC name is (10R)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-quinolin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-quinolin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125122445 |
| Molecular Formula | C29H21NO7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (10R)-3-(3,4-dimethoxyphenyl)-5-hydroxy-10-quinolin-6-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)C[C@@H]4c2ccc3ncccc3c2)cc1OC |
| InChI | InChI=1S/C29H21NO7/c1-34-22-8-6-16(11-23(22)35-2)19-14-36-29-26-18(15-5-7-20-17(10-15)4-3-9-30-20)12-25(32)37-24(26)13-21(31)27(29)28(19)33/h3-11,13-14,18,31H,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | JVTQXRAZPBJQKO-GOSISDBHSA-N |
| XLogP | 5.17 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|