C28H20O7 — CID 97045927
(10R)-10-(2H-chromen-3-yl)-5-hydroxy-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97045927) has the molecular formula C28H20O7 and a molecular weight of 468.46 g/mol. Its IUPAC name is (10R)-10-(2H-chromen-3-yl)-5-hydroxy-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-10-(2H-chromen-3-yl)-5-hydroxy-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97045927 |
| Molecular Formula | C28H20O7 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (10R)-10-(2H-chromen-3-yl)-5-hydroxy-3-(4-methoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)C[C@@H]4C2=Cc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C28H20O7/c1-32-18-8-6-15(7-9-18)20-14-34-28-25-19(17-10-16-4-2-3-5-22(16)33-13-17)11-24(30)35-23(25)12-21(29)26(28)27(20)31/h2-10,12,14,19,29H,11,13H2,1H3/t19-/m1/s1 |
| InChIKey | SMEQCSGJQPVTTH-LJQANCHMSA-N |
| XLogP | 5.04 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|