C27H19FO8 — CID 124879709
2-[4-[(10R)-3-(4-fluorophenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]-2-methoxyphenoxy]acetic acid (PubChem CID 124879709) has the molecular formula C27H19FO8 and a molecular weight of 490.44 g/mol. Its IUPAC name is 2-[4-[(10R)-3-(4-fluorophenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(10R)-3-(4-fluorophenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 124879709 |
| Molecular Formula | C27H19FO8 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[4-[(10R)-3-(4-fluorophenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc([C@H]2CC(=O)Oc3ccc4c(=O)c(-c5ccc(F)cc5)coc4c32)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H19FO8/c1-33-22-10-15(4-8-20(22)34-13-23(29)30)18-11-24(31)36-21-9-7-17-26(32)19(12-35-27(17)25(18)21)14-2-5-16(28)6-3-14/h2-10,12,18H,11,13H2,1H3,(H,29,30)/t18-/m1/s1 |
| InChIKey | VPFLSSVGIWEFJJ-GOSISDBHSA-N |
| XLogP | 4.51 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|