C25H17FO6 — CID 110207416
3-(4-fluorophenyl)-10-(4-hydroxy-3-methoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 110207416) has the molecular formula C25H17FO6 and a molecular weight of 432.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-10-(4-hydroxy-3-methoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 3-(4-fluorophenyl)-10-(4-hydroxy-3-methoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 110207416 |
| Molecular Formula | C25H17FO6 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-(4-fluorophenyl)-10-(4-hydroxy-3-methoxyphenyl)-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3ccc4c(=O)c(-c5ccc(F)cc5)coc4c32)ccc1O |
| InChI | InChI=1S/C25H17FO6/c1-30-21-10-14(4-8-19(21)27)17-11-22(28)32-20-9-7-16-24(29)18(12-31-25(16)23(17)20)13-2-5-15(26)6-3-13/h2-10,12,17,27H,11H2,1H3 |
| InChIKey | RBEQMLGTRGRXRV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|