C27H16O6 — CID 124879681
(10R)-10-(4-oxochromen-3-yl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 124879681) has the molecular formula C27H16O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is (10R)-10-(4-oxochromen-3-yl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10R)-10-(4-oxochromen-3-yl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 124879681 |
| Molecular Formula | C27H16O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (10R)-10-(4-oxochromen-3-yl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2coc3ccccc3c2=O)c2c(ccc3c(=O)c(-c4ccccc4)coc23)O1 |
| InChI | InChI=1S/C27H16O6/c28-23-12-18(20-14-31-21-9-5-4-8-16(21)25(20)29)24-22(33-23)11-10-17-26(30)19(13-32-27(17)24)15-6-2-1-3-7-15/h1-11,13-14,18H,12H2/t18-/m0/s1 |
| InChIKey | VIXXNXJRKPPERI-SFHVURJKSA-N |
| XLogP | 5.01 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|