About 3-phenylchromen-4-one;phosphane
3-phenylchromen-4-one;phosphane (PubChem CID 174413449) has the molecular formula C15H13O2P
and a molecular weight of 256.24 g/mol. Its IUPAC name is 3-phenylchromen-4-one;phosphane.
Molecular Properties
| Compound Name | 3-phenylchromen-4-one;phosphane |
| PubChem CID | 174413449 |
| Molecular Formula | C15H13O2P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-phenylchromen-4-one;phosphane |
| SMILES | O=c1c(-c2ccccc2)coc2ccccc12.P |
| InChI | InChI=1S/C15H10O2.H3P/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11;/h1-10H;1H3 |
| InChIKey | JOCIHZPPXKGSGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylchromen-4-one;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylchromen-4-one;phosphane?
The IUPAC name of 3-phenylchromen-4-one;phosphane (CID 174413449) is 3-phenylchromen-4-one;phosphane.
What is the SMILES notation for 3-phenylchromen-4-one;phosphane?
The canonical SMILES for 3-phenylchromen-4-one;phosphane is O=c1c(-c2ccccc2)coc2ccccc12.P.
What is the InChIKey of 3-phenylchromen-4-one;phosphane?
The InChIKey is JOCIHZPPXKGSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2.H3P/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11;/h1-10H;1H3.
What are the key properties of 3-phenylchromen-4-one;phosphane?
3-phenylchromen-4-one;phosphane has a molecular weight of 256.24 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylchromen-4-one;phosphane is sourced from PubChem (CID 174413449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).