C32H32O5 — CID 124873437
(10S)-10-(4-octoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 124873437) has the molecular formula C32H32O5 and a molecular weight of 496.60 g/mol. Its IUPAC name is (10S)-10-(4-octoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | (10S)-10-(4-octoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 124873437 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (10S)-10-(4-octoxyphenyl)-3-phenyl-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | CCCCCCCCOc1ccc([C@@H]2CC(=O)Oc3ccc4c(=O)c(-c5ccccc5)coc4c32)cc1 |
| InChI | InChI=1S/C32H32O5/c1-2-3-4-5-6-10-19-35-24-15-13-23(14-16-24)26-20-29(33)37-28-18-17-25-31(34)27(21-36-32(25)30(26)28)22-11-8-7-9-12-22/h7-9,11-18,21,26H,2-6,10,19-20H2,1H3/t26-/m0/s1 |
| InChIKey | ACJZIPGOORNNMH-SANMLTNESA-N |
| XLogP | 7.64 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|