C32H31ClO6 — CID 110207136
3-(4-chlorophenyl)-5-hydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 110207136) has the molecular formula C32H31ClO6 and a molecular weight of 547.05 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-hydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 3-(4-chlorophenyl)-5-hydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 110207136 |
| Molecular Formula | C32H31ClO6 |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 3-(4-chlorophenyl)-5-hydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CCCCCCCCOc1ccc(C2CC(=O)Oc3cc(O)c4c(=O)c(-c5ccc(Cl)cc5)coc4c32)cc1 |
| InChI | InChI=1S/C32H31ClO6/c1-2-3-4-5-6-7-16-37-23-14-10-20(11-15-23)24-17-28(35)39-27-18-26(34)30-31(36)25(19-38-32(30)29(24)27)21-8-12-22(33)13-9-21/h8-15,18-19,24,34H,2-7,16-17H2,1H3 |
| InChIKey | JJSVMLBUBJEKGD-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|