C32H32O9 — CID 98885081
(10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 98885081) has the molecular formula C32H32O9 and a molecular weight of 560.60 g/mol. Its IUPAC name is (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 98885081 |
| Molecular Formula | C32H32O9 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (10R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(4-octoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CCCCCCCCOc1ccc([C@H]2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1 |
| InChI | InChI=1S/C32H32O9/c1-2-3-4-5-6-7-14-39-20-11-8-18(9-12-20)21-16-26(36)40-25-17-24(35)28-29(37)30(38)31(41-32(28)27(21)25)19-10-13-22(33)23(34)15-19/h8-13,15,17,21,33-35,38H,2-7,14,16H2,1H3/t21-/m1/s1 |
| InChIKey | QBHFNFLBWWPGKN-OAQYLSRUSA-N |
| XLogP | 6.46 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|